CymitQuimica logo

CAS 115652-65-8

:

2-(Trifluoromethyl)pyrido[2,3-b]pyrazine

Description:
2-(Trifluoromethyl)pyrido[2,3-b]pyrazine is a heterocyclic compound characterized by its unique structure, which includes a pyridine and pyrazine moiety fused together, along with a trifluoromethyl group (-CF3) attached to the pyridine ring. This trifluoromethyl group significantly influences the compound's chemical properties, enhancing its lipophilicity and potentially its biological activity. The presence of fluorine atoms often imparts increased stability and alters the reactivity of the compound compared to its non-fluorinated counterparts. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its applications may span various fields, including pharmaceuticals, agrochemicals, and materials science, due to its potential as a building block in the synthesis of more complex molecules. Additionally, the presence of multiple nitrogen atoms in the structure can contribute to its ability to form hydrogen bonds, which may be relevant in biological interactions. Overall, 2-(Trifluoromethyl)pyrido[2,3-b]pyrazine is a compound of interest for its unique structural features and potential applications.
Formula:C8H4F3N3
InChI:InChI=1S/C8H4F3N3/c9-8(10,11)6-4-13-7-5(14-6)2-1-3-12-7/h1-4H
InChI key:InChIKey=WJVCUGNSRAKHQG-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=NC2=C(N=C1)N=CC=C2
Synonyms:
  • Pyrido[2,3-b]pyrazine, 2-(trifluoromethyl)-
  • 2-(Trifluoromethyl)pyrido[2,3-b]pyrazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.