CymitQuimica logo

CAS 115654-39-2

:

(S)-[2-[[(tert-Butoxy)carbonyl]amino]-4-methylpentyl]carbamic acid benzyl ester

Description:
The chemical substance known as (S)-[2-[[(tert-Butoxy)carbonyl]amino]-4-methylpentyl]carbamic acid benzyl ester, with the CAS number 115654-39-2, is a chiral compound that belongs to the class of carbamic acid derivatives. It features a tert-butoxycarbonyl (Boc) protecting group, which is commonly used in organic synthesis to protect amines during reactions. The presence of the benzyl ester indicates that the compound has an aromatic component, which can influence its solubility and reactivity. The (S) configuration denotes that it is one of the enantiomers, which can exhibit different biological activities compared to its counterpart. This compound is likely to be soluble in organic solvents due to its hydrophobic characteristics, while the presence of the carbamic acid moiety may impart some degree of polarity. Such compounds are often utilized in pharmaceutical chemistry for drug development, particularly in the synthesis of peptide-based therapeutics. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the overall structure of the compound.
Formula:C19H30N2O4
InChI:InChI=1/C19H30N2O4/c1-14(2)11-16(21-18(23)25-19(3,4)5)12-20-17(22)24-13-15-9-7-6-8-10-15/h6-10,14,16H,11-13H2,1-5H3,(H,20,22)(H,21,23)/t16-/m0/s1
SMILES:CC(C)C[C@@H](CN=C(O)OCc1ccccc1)N=C(O)OC(C)(C)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.