CymitQuimica logo

CAS 115654-59-6

:

BOC-L-LEU-NITRILE

Description:
BOC-L-Leu-nitrile, with the CAS number 115654-59-6, is a chemical compound that features a tert-butyloxycarbonyl (BOC) protecting group attached to the amino acid leucine, along with a nitrile functional group. This compound is typically used in peptide synthesis and organic chemistry as a building block due to its ability to protect the amino group during reactions. The BOC group is known for its stability under various reaction conditions, allowing for selective deprotection when needed. The presence of the nitrile group introduces a polar functional group, which can influence the compound's solubility and reactivity. BOC-L-Leu-nitrile is generally characterized by its solid state at room temperature and may exhibit specific melting and boiling points, depending on the purity and specific conditions. Its applications extend to pharmaceutical research and development, particularly in the synthesis of biologically active peptides. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards.
Formula:C11H20N2O2
InChI:InChI=1/C11H20N2O2/c1-8(2)6-9(7-12)13-10(14)15-11(3,4)5/h8-9H,6H2,1-5H3,(H,13,14)/t9-/m0/s1
SMILES:CC(C)C[C@@H](C#N)N=C(O)OC(C)(C)C
Synonyms:
  • Boc-Leu-Nitrile
  • Carbamic acid, N-[(1S)-1-cyano-3-methylbutyl]-, 1,1-dimethylethyl ester
  • tert-butyl [(1S)-1-cyano-3-methylbutyl]carbamate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.