CAS 1156542-31-2

5-Fluoro-4-(trifluoromethyl)-2-pyridinecarbonitrile

Description:

5-Fluoro-4-(trifluoromethyl)-2-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 5-position and a trifluoromethyl group at the 4-position significantly influences its chemical properties, including its reactivity and polarity. The cyano group (-C≡N) at the 2-position contributes to its potential as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its unique functional groups can participate in various chemical reactions, such as nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the trifluoromethyl group enhances lipophilicity, which can affect the compound's biological activity and solubility in organic solvents. Overall, 5-Fluoro-4-(trifluoromethyl)-2-pyridinecarbonitrile is of interest in medicinal chemistry and materials science due to its distinctive structural features and potential applications.

Formula: C₇H₂F₄N₂

InChI: InChI=1S/C7H2F4N2/c8-6-3-13-4(2-12)1-5(6)7(9,10)11/h1,3H

InChI key: InChIKey=OZUXRRLCZZLVAT-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C#N)N=CC1F

Synonyms:

• 5-Fluoro-4-(trifluoromethyl)-2-pyridinecarbonitrile
• 2-Pyridinecarbonitrile, 5-fluoro-4-(trifluoromethyl)-