CAS 115655-08-8
:ethyl (3S)-piperidine-3-carboxylate hydrochloride
Description:
Ethyl (3S)-piperidine-3-carboxylate hydrochloride is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features an ethyl ester functional group attached to the piperidine, specifically at the 3-position, indicating that the carboxylate moiety is linked to the nitrogen atom in the ring. The presence of the hydrochloride indicates that the compound is in its salt form, which enhances its solubility in water and may influence its stability and bioavailability. This compound is often utilized in organic synthesis and pharmaceutical applications, particularly in the development of various bioactive molecules. Its stereochemistry, denoted by the (3S) configuration, suggests that it has specific spatial arrangements that can affect its interaction with biological targets. As with many piperidine derivatives, it may exhibit a range of pharmacological activities, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C8H16ClNO2
InChI:InChI=1/C8H15NO2.ClH/c1-2-11-8(10)7-4-3-5-9-6-7;/h7,9H,2-6H2,1H3;1H/t7-;/m0./s1
SMILES:CCOC(=O)[C@H]1CCCNC1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
