CAS 115656-08-1
:4-BROMO-2,3,7,8-TETRACHLORODIBENZOFURAN
Description:
4-Bromo-2,3,7,8-tetrachlorodibenzofuran (CAS 115656-08-1) is a synthetic organic compound belonging to the class of dibenzofurans, which are polycyclic aromatic compounds. This substance is characterized by its complex structure, featuring multiple halogen substituents, specifically four chlorine atoms and one bromine atom, which significantly influence its chemical properties and reactivity. It is known for its environmental persistence and potential toxicity, particularly as a contaminant in various ecosystems. The presence of halogens typically enhances the compound's lipophilicity, leading to bioaccumulation in living organisms. 4-Bromo-2,3,7,8-tetrachlorodibenzofuran is often studied in the context of environmental chemistry and toxicology due to its potential effects on human health and wildlife. Its stability and resistance to degradation make it a subject of concern in pollution studies, particularly regarding its formation and persistence in industrial processes. Safety measures are essential when handling this compound, given its hazardous nature and potential environmental impact.
Formula:C12H3BrCl4O
InChI:InChI=1/C12H3BrCl4O/c13-10-11(17)8(16)2-5-4-1-6(14)7(15)3-9(4)18-12(5)10/h1-3H
SMILES:c1c2c3cc(c(c(c3oc2cc(c1Cl)Cl)Br)Cl)Cl
Synonyms:- Dibenzofuran, 4-bromo-2,3,7,8-tetrachloro-
- 4-Bromo-2,3,7,8-Tetrachlorodibenzo[B,D]Furan
- 4-Bromo-2,3,7,8-tetrachlorodibenzofuran
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
