CymitQuimica logo

CAS 1156602-20-8

:

1-(Tetrahydro-1,1-dioxido-3-thienyl)-1H-pyrazol-4-amine

Description:
1-(Tetrahydro-1,1-dioxido-3-thienyl)-1H-pyrazol-4-amine is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a thienyl group. The presence of the tetrahydro-1,1-dioxide moiety contributes to its potential reactivity and solubility properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions or coordination with metal ions. The compound's specific properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Additionally, the compound's safety and handling would be guided by standard protocols for chemical substances, including considerations for toxicity and environmental impact. Overall, 1-(Tetrahydro-1,1-dioxido-3-thienyl)-1H-pyrazol-4-amine represents a class of compounds that may have significant applications in pharmaceuticals and materials science.
Formula:C7H11N3O2S
InChI:InChI=1S/C7H11N3O2S/c8-6-3-9-10(4-6)7-1-2-13(11,12)5-7/h3-4,7H,1-2,5,8H2
InChI key:InChIKey=IVTUQRCGUSIBGT-UHFFFAOYSA-N
SMILES:O=S1(=O)CC(CC1)N2N=CC(N)=C2
Synonyms:
  • 1-(Tetrahydro-1,1-dioxido-3-thienyl)-1H-pyrazol-4-amine
  • 1H-Pyrazol-4-amine, 1-(tetrahydro-1,1-dioxido-3-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.