CymitQuimica logo

CAS 115662-06-1

:

5,6,12,13-Tetrachloroanthra[2,1,9-def:6,5,10-d'e'f′]diisoquinoline-1,3,8,10(2H,9H)-tetrone

Description:
5,6,12,13-Tetrachloroanthra[2,1,9-def:6,5,10-d'e'f′]diisoquinoline-1,3,8,10(2H,9H)-tetrone, with CAS number 115662-06-1, is a complex organic compound characterized by its polycyclic structure, which includes multiple fused aromatic rings. This substance features a tetrone functional group, indicating the presence of four carbonyl (C=O) groups, contributing to its potential reactivity and stability. The incorporation of chlorine atoms enhances its chemical properties, potentially affecting its solubility, reactivity, and biological activity. The compound's intricate structure suggests it may exhibit interesting electronic properties, making it a candidate for applications in materials science or organic electronics. Additionally, due to its polycyclic nature, it may possess significant photophysical properties, which could be relevant in fields such as photochemistry or dye synthesis. However, the specific applications and safety considerations would depend on further research into its toxicity and environmental impact. Overall, this compound represents a unique class of chlorinated polycyclic compounds with potential utility in various chemical applications.
Formula:C24H6Cl4N2O4
InChI:InChI=1S/C24H6Cl4N2O4/c25-9-1-5-13-6(22(32)29-21(5)31)2-11(27)17-18-12(28)4-8-14-7(23(33)30-24(8)34)3-10(26)16(20(14)18)15(9)19(13)17/h1-4H,(H,29,31,32)(H,30,33,34)
InChI key:InChIKey=SOGFVOVSOPPQPF-UHFFFAOYSA-N
SMILES:ClC1=C2C3=C4C(C(=O)NC(=O)C4=C1)=CC(Cl)=C3C=5C=6C2=C(Cl)C=C7C6C(=CC5Cl)C(=O)NC7=O
Synonyms:
  • 1,6,7,12-Tetrachloro-3,4,9,10-tetracarboxylic acid diimide
  • Anthra[2,1,9-def:6,5,10-d'e'f′]diisoquinoline-1,3,8,10(2H,9H)-tetrone, 5,6,12,13-tetrachloro-
  • 5,6,12,13-Tetrachloroanthra[2,1,9-def:6,5,10-d'e'f′]diisoquinoline-1,3,8,10(2H,9H)-tetrone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.