
CAS 115665-78-6
:1-[(1E)-2-Bromoethenyl]-4-(trifluoromethyl)benzene
Description:
1-[(1E)-2-Bromoethenyl]-4-(trifluoromethyl)benzene, with the CAS number 115665-78-6, is an organic compound characterized by its unique structural features. It consists of a brominated vinyl group attached to a benzene ring that also contains a trifluoromethyl substituent. The presence of the bromine atom introduces reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The trifluoromethyl group significantly influences the compound's electronic properties, enhancing its lipophilicity and stability, which can affect its behavior in biological systems and its utility in materials science. This compound is typically used in research and development, particularly in the synthesis of more complex organic molecules. Its physical properties, such as boiling point, melting point, and solubility, are influenced by the functional groups present, and it may exhibit interesting spectral characteristics in techniques like NMR and IR spectroscopy. Overall, this compound is of interest in both synthetic organic chemistry and potential applications in pharmaceuticals and agrochemicals.
Formula:C9H6BrF3
InChI:InChI=1S/C9H6BrF3/c10-6-5-7-1-3-8(4-2-7)9(11,12)13/h1-6H/b6-5+
InChI key:InChIKey=GGXGMQKZNYMKEH-AATRIKPKSA-N
SMILES:C(F)(F)(F)C1=CC=C(/C=C/Br)C=C1
Synonyms:- 1-[(1E)-2-Bromoethenyl]-4-(trifluoromethyl)benzene
- Benzene, 1-[(1E)-2-bromoethenyl]-4-(trifluoromethyl)-
- Benzene, 1-(2-bromoethenyl)-4-(trifluoromethyl)-, (E)-
- trans-β-Bromo-4-(trifluoromethyl)styrene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.