CAS 115666-43-8
:1-(2,3-Dihydro-6-iodo-1H-indol-1-yl)ethanone
Description:
1-(2,3-Dihydro-6-iodo-1H-indol-1-yl)ethanone, with the CAS number 115666-43-8, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features a 6-iodo substitution on the indole moiety, which can influence its reactivity and biological activity. The presence of the ethanone functional group indicates that it contains a carbonyl group (C=O) adjacent to an ethyl group, contributing to its potential as a reactive electrophile. The dihydro form suggests that the compound has a saturated bond in the indole structure, which may affect its stability and interactions. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmacology. Its iodine substitution can also enhance its lipophilicity and influence its binding affinity to biological targets. Overall, the unique structural features of this compound contribute to its potential applications in research and development.
Formula:C10H10INO
InChI:InChI=1S/C10H10INO/c1-7(13)12-5-4-8-2-3-9(11)6-10(8)12/h2-3,6H,4-5H2,1H3
InChI key:InChIKey=QYOUFIOXEFUHAU-UHFFFAOYSA-N
SMILES:C(C)(=O)N1C=2C(CC1)=CC=C(I)C2
Synonyms:- Ethanone, 1-(2,3-dihydro-6-iodo-1H-indol-1-yl)-
- 1H-Indole, 1-acetyl-2,3-dihydro-6-iodo-
- 1-Acetyl-2,3-dihydro-6-iodoindole
- 1-(2,3-Dihydro-6-iodo-1H-indol-1-yl)ethanone
- 1-Acetyl-6-iodoindoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
