CAS 115666-46-1

6-IODO-2,3-DIHYDRO-1H-INDOLE HYDROCHLORIDE

Description:

6-Iodo-2,3-dihydro-1H-indole hydrochloride is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of the iodine atom at the 6-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including medicinal chemistry. This compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals. Its structural features suggest that it could interact with biological targets, making it of interest in drug discovery. However, specific details regarding its toxicity, stability, and reactivity would require further investigation through experimental studies. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with iodine-containing compounds.

Formula: C₈H₉ClIN

InChI: InChI=1S/C8H8IN/c9-7-2-1-6-3-4-10-8(6)5-7/h1-2,5,10H,3-4H2

InChI key: KGCBZEKELZUOFI-UHFFFAOYSA-N

SMILES: C1CNC2=C1C=CC(=C2)I

6-Iodoindoline

CAS: 115666-46-1

6-Iodoindoline

Formula: C₈H₈IN

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 245.06029

Ref: 54-OR17617

6-Iodoindoline

CAS: 115666-46-1

Formula: C₈H₈IN

Purity: 95%

Color and Shape: Solid

Molecular weight: 245.0603

Ref: IN-DA000GQP

6-Iodoindoline

CAS: 115666-46-1

6-Iodoindoline

Formula: C₈H₈IN

Purity: 98%

Molecular weight: 245.06

Ref: IN-DG30350

6-Iodo-2,3-dihydro-1H-indole

CAS: 115666-46-1

6-Iodo-2,3-dihydro-1H-indole is an analog of 6-iodoindole which is a conformationally rigid analogue. It has been shown to have a high affinity for 5-HT6 receptors with a pharmacokinetic profile. This compound has also been shown to be effective in the treatment of depression and anxiety disorders. The pharmacokinetic properties of this compound are not well understood, but it may be due to its steric similarity to other heterocycles.

Formula: C₈H₈IN

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 245.06 g/mol

Ref: 3D-FI52127

6-Iodoindoline

CAS: 115666-46-1

Formula: C₈H₈IN

Purity: 95%

Color and Shape: Solid

Molecular weight: 245.063

Ref: 10-F223414