CymitQuimica logo

CAS 115699-74-6

:

2-chloro-N-(pyrazin-2-yl)acetamide

Description:
2-Chloro-N-(pyrazin-2-yl)acetamide is a chemical compound characterized by its unique structure, which includes a chloro group and a pyrazinyl moiety attached to an acetamide functional group. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrazine ring, which is known for its biological activity. The chloro substituent may enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the presence of the acetamide group can contribute to hydrogen bonding capabilities, affecting its solubility and stability. As with many chemical substances, safety precautions should be observed when handling this compound, as it may exhibit toxicity or irritant properties. Overall, 2-chloro-N-(pyrazin-2-yl)acetamide represents a compound of interest for further research and potential applications in various fields, including agrochemicals and pharmaceuticals.
Formula:C6H6ClN3O
InChI:InChI=1/C6H6ClN3O/c7-3-6(11)10-5-4-8-1-2-9-5/h1-2,4H,3H2,(H,9,10,11)
SMILES:c1cnc(cn1)N=C(CCl)O
Synonyms:
  • acetamide, 2-chloro-N-2-pyrazinyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.