CAS 1157-39-7: 4′,7-Dimethoxyisoflavone
Description:4′,7-Dimethoxyisoflavone, with the CAS number 1157-39-7, is a naturally occurring isoflavone, a class of compounds known for their structural similarity to estrogens. This compound features two methoxy groups (-OCH3) attached to the isoflavone backbone, specifically at the 4' and 7 positions, which can influence its biological activity and solubility. Isoflavones are primarily found in legumes, particularly soybeans, and are recognized for their potential health benefits, including antioxidant properties and possible roles in hormone regulation. 4′,7-Dimethoxyisoflavone has garnered interest in research for its potential effects on human health, including anti-inflammatory and anticancer properties. Its chemical structure contributes to its ability to interact with various biological targets, making it a subject of study in pharmacology and nutrition. As with many isoflavones, its bioavailability and efficacy can be influenced by factors such as dietary intake and metabolism. Overall, 4′,7-Dimethoxyisoflavone represents a significant compound within the realm of phytochemicals with potential therapeutic applications.
Formula:C17H14O4
InChI:InChI=1S/C17H14O4/c1-19-12-5-3-11(4-6-12)15-10-21-16-9-13(20-2)7-8-14(16)17(15)18/h3-10H,1-2H3
InChI key:InChIKey=LPNBCGIVZXHHHO-UHFFFAOYSA-N
SMILES:O=C1C(=COC2=CC(OC)=CC=C21)C=3C=CC(OC)=CC3
- Synonyms:
- 4H-1-Benzopyran-4-one, 7-methoxy-3-(4-methoxyphenyl)-
- 4′,7-Di-O-methyldaidzein
- 4′,7-Dimethoxyisoflavone
- 4′,7-Dimethoxylisoflavone
- 7,4'-Dimethoxyisoflavone
- 7-Methoxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- 7-O-Methylformononetin
- 7-methoxy-3-(4-methoxyphenyl)-4H-chromen-4-one
- Di-O-methyldaidzein
- Dimethoxydaidzein
- See more synonyms
- Formononetin 7-O-methyl ether
- Formononetin methyl ether
- Isoflavone, 4′,7-dimethoxy-
- 4',7-Dimethoxyisoflavone
