CAS 1157009-60-3

1-Ethyl-N-(tetrahydro-2H-pyran-4-yl)-2-pyrrolidinemethanamine

Description:

1-Ethyl-N-(tetrahydro-2H-pyran-4-yl)-2-pyrrolidinemethanamine, identified by its CAS number 1157009-60-3, is a chemical compound characterized by its unique molecular structure, which includes a pyrrolidine ring and a tetrahydro-pyran moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the ethyl group and the tetrahydro-pyran ring may contribute to its lipophilicity, potentially affecting its biological activity and interaction with cellular membranes. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in pharmaceuticals, particularly in the design of compounds targeting neurological or psychological conditions, although specific biological activities would require further investigation. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.

Formula: C₁₂H₂₄N₂O

InChI: InChI=1S/C12H24N2O/c1-2-14-7-3-4-12(14)10-13-11-5-8-15-9-6-11/h11-13H,2-10H2,1H3

InChI key: InChIKey=GXGBSTPRTBNFKD-UHFFFAOYSA-N

SMILES: C(NC1CCOCC1)C2N(CC)CCC2

Synonyms:

• 2-Pyrrolidinemethanamine, 1-ethyl-N-(tetrahydro-2H-pyran-4-yl)-
• 1-Ethyl-N-(tetrahydro-2H-pyran-4-yl)-2-pyrrolidinemethanamine