CAS 115706-19-9

6,7-Dichloro-3,4-dihydro-1(2H)-isoquinolinone

Description:

6,7-Dichloro-3,4-dihydro-1(2H)-isoquinolinone is a chemical compound characterized by its isoquinolinone structure, which features a bicyclic system comprising a benzene ring fused to a pyrrolidine-like ring. This compound contains two chlorine substituents at the 6 and 7 positions, contributing to its unique reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the dichloro groups can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. This compound is of interest in medicinal chemistry due to its potential pharmacological applications, particularly in the development of therapeutic agents. Its CAS number, 115706-19-9, allows for precise identification in chemical databases. As with many halogenated compounds, it is essential to handle it with care, considering potential toxicity and environmental impact. Overall, 6,7-Dichloro-3,4-dihydro-1(2H)-isoquinolinone represents a significant structure for further research in chemical and pharmaceutical sciences.

Formula: C₉H₇Cl₂NO

InChI: InChI=1S/C9H7Cl2NO/c10-7-3-5-1-2-12-9(13)6(5)4-8(7)11/h3-4H,1-2H2,(H,12,13)

InChI key: InChIKey=FOJPMUIDVJQSSA-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC(Cl)=C(Cl)C2)CCN1

Synonyms:

• 1(2H)-Isoquinolinone, 6,7-dichloro-3,4-dihydro-
• 6,7-Dichloro-3,4-dihydro-1(2H)-isoquinolinone