CAS 115706-39-3
:1H-1-Benzazepine-1-acetic acid, 2,3,4,5-tetrahydro--alpha--methyl-2-oxo-
Description:
1H-1-Benzazepine-1-acetic acid, 2,3,4,5-tetrahydro-alpha-methyl-2-oxo- (CAS 115706-39-3) is a chemical compound characterized by its unique bicyclic structure, which incorporates a benzazepine moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and an acetic acid functional group that contributes to its acidity and potential reactivity. The alpha-methyl and keto functionalities enhance its chemical properties, potentially influencing its biological activity. Typically, compounds of this class may exhibit pharmacological properties, making them of interest in medicinal chemistry. The presence of multiple functional groups suggests that it may participate in various chemical reactions, including esterification or amidation. Additionally, the compound's solubility, stability, and reactivity can be influenced by its molecular structure, which may affect its application in drug development or as a research chemical. Overall, this compound represents a complex structure with potential implications in therapeutic contexts, warranting further investigation into its properties and applications.
Formula:C13H15NO3
InChI:InChI=1S/C13H15NO3/c1-9(13(16)17)14-11-7-3-2-5-10(11)6-4-8-12(14)15/h2-3,5,7,9H,4,6,8H2,1H3,(H,16,17)
InChI key:NXTIVKFWBOWRDP-UHFFFAOYSA-N
SMILES:CC(C(=O)O)N1C(=O)CCCC2=CC=CC=C21
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery