CAS 115732-15-5
:2-BENZOYL-1,2,3,4-TETRAHYDRO-ISOQUINOLINE-3-CARBOXYLIC ACID
Description:
2-Benzoyl-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid, with the CAS number 115732-15-5, is a chemical compound that belongs to the class of isoquinoline derivatives. This substance features a tetrahydroisoquinoline core, which is characterized by a bicyclic structure containing a nitrogen atom. The presence of a benzoyl group and a carboxylic acid functional group contributes to its unique chemical properties. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have limited solubility in water due to their hydrophobic aromatic components. The carboxylic acid group can participate in hydrogen bonding, influencing the compound's reactivity and potential interactions in biological systems. Additionally, such isoquinoline derivatives are often studied for their pharmacological properties, including potential applications in medicinal chemistry. Overall, the characteristics of this compound make it of interest in various fields, including organic synthesis and drug development.
Formula:C17H15NO3
InChI:InChI=1/C17H15NO3/c19-16(12-6-2-1-3-7-12)18-11-14-9-5-4-8-13(14)10-15(18)17(20)21/h1-9,15H,10-11H2,(H,20,21)
SMILES:c1ccc(cc1)C(=O)N1Cc2ccccc2CC1C(=O)O
Synonyms:- 2-Benzoyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid
- 3-Isoquinolinecarboxylic acid, 2-benzoyl-1,2,3,4-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(3S)-2-benzoyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid
CAS:Formula:C17H15NO3Molecular weight:281.3059
