CymitQuimica logo

CAS 115754-21-7

:

3-fluoro-4-(trifluoromethyl)benzoic acid

Description:
3-Fluoro-4-(trifluoromethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a trifluoromethyl group attached to a benzene ring. The molecular structure features a benzoic acid moiety, which includes a carboxylic acid functional group (-COOH) that imparts acidic properties. The fluorine substituents enhance the compound's lipophilicity and can influence its reactivity and interaction with biological systems. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique electronic properties, due to the electronegative fluorine atoms, can affect the acidity and stability of the carboxylic acid group. Additionally, the presence of multiple fluorine atoms can contribute to the compound's overall hydrophobic character, making it of interest in various chemical applications. Safety data should be consulted for handling and storage, as fluorinated compounds can exhibit specific hazards.
Formula:C8H4F4O2
InChI:InChI=1/C8H4F4O2/c9-6-3-4(7(13)14)1-2-5(6)8(10,11)12/h1-3H,(H,13,14)/p-1
InChI key:HRIHSNPFVGMAKX-UHFFFAOYSA-N
SMILES:c1cc(c(cc1C(=O)[O-])F)C(F)(F)F
Synonyms:
  • alpha,alpha,alpha,3-Tetrafluoro-p-toluic acid
  • 1-(2,4-Difluorophenyl)Piperazine
  • 3-Fluoro-4-(Trifluoromethyl)Benzoate
  • 3-Fluoro-4-(trifluoromethyl)benzoic aicd
  • 3-Fluoro-4-trifluoromethylbenzoic acid
  • See more synonyms
Found 9 products.