CAS 115754-88-6: 2-(2-Furanyl)cycloheptanol

Description:2-(2-Furanyl)cycloheptanol is an organic compound characterized by its unique structure, which features a cycloheptanol ring substituted with a furanyl group. The presence of the furan ring, a five-membered aromatic heterocycle containing oxygen, imparts distinct chemical properties, including potential reactivity and solubility characteristics. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It may exhibit moderate polarity due to the hydroxyl (-OH) group in the cycloheptanol structure, influencing its solubility in various solvents. The compound's potential applications could span fields such as pharmaceuticals, agrochemicals, or materials science, owing to the biological activity often associated with furan derivatives. Additionally, its synthesis may involve standard organic reactions, including cyclization and functional group transformations. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.

Formula:C₁₁H₁₆O₂

InChI:InChI=1S/C11H16O2/c12-10-6-3-1-2-5-9(10)11-7-4-8-13-11/h4,7-10,12H,1-3,5-6H2

InChI key:InChIKey=DMYKVGCQIASCOS-UHFFFAOYSA-N

SMILES:OC1CCCCCC1C=2OC=CC2