CAS 115761-79-0

Difluorophenylpiperazine

Description:

Difluorophenylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of two fluorine atoms on the phenyl ring significantly influences its chemical properties, including its reactivity and polarity. This compound is often studied in the context of pharmacology and medicinal chemistry due to its potential biological activity, particularly as a serotonin receptor modulator. Difluorophenylpiperazine may exhibit various effects on the central nervous system, making it of interest in research related to anxiety, depression, and other mood disorders. Its molecular structure allows for interactions with neurotransmitter systems, which can lead to diverse pharmacological effects. Additionally, the compound's solubility and stability can vary based on environmental conditions, such as pH and temperature. Safety and handling precautions are essential when working with this substance, as with many chemical compounds, due to potential toxicity and environmental impact. Overall, difluorophenylpiperazine serves as a valuable compound in both research and potential therapeutic applications.

Formula: C₁₀H₁₃F₂N₂

InChI: InChI=1/C10H12F2N2/c11-8-1-2-10(9(12)7-8)14-5-3-13-4-6-14/h1-2,7,13H,3-6H2/p+1

Synonyms:

• 1-(2,4-Difluorophenyl)piperazine
• 4-(2,4-Difluorophenyl)Piperazin-1-Ium

Piperazine, 1-(2,4-difluorophenyl)-

CAS: 115761-79-0

Formula: C₁₀H₁₂F₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 198.2125

Ref: IN-DA000GTR

1-(2,4-Difluorophenyl)piperazine

CAS: 115761-79-0

Purity: 99%

Molecular weight: 198.212

Ref: FT-D15512

1-(2,4-Difluorophenyl)piperazine

CAS: 115761-79-0

Purity: 98.0%

Color and Shape: Liquid, Oil

Molecular weight: 198.2169952392578

Ref: 10-F009771

1-(2,4-Difluorophenyl)piperazine

Controlled Product

CAS: 115761-79-0

Applications 1-(2,4-difluorophenyl)piperazine
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₁₀H₁₂F₂N₂

Color and Shape: Neat

Molecular weight: 198.21

Ref: TR-D451285

1-(2,4-Difluorophenyl)piperazine

Controlled Product

CAS: 115761-79-0

1-(2,4-Difluorophenyl)piperazine (1-DFPP) is a novel triazolopyrimidine derivative that has been shown to inhibit the growth of cancer cells. This drug is an inhibitor of regulatory GTPases and primary amines, which are involved in the regulation of cell proliferation. 1-DFPP also inhibits the ring-opening reaction and can be used for optimization of arylpiperazines. It has been shown to have inhibitory activities on both TNF-α and IL-10 in vitro. The drug was evaluated orally in mice and showed promising results with regards to reducing inflammation. 1-DFPP is currently undergoing clinical trials as an anti-cancer agent.

Formula: C₁₀H₁₂F₂N₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 198.21 g/mol

Ref: 3D-FD80497