CAS 115773-21-2

Benzene, 1-(1-bromoethyl)-4-propyl-

Description:

Benzene, 1-(1-bromoethyl)-4-propyl-, also known by its CAS number 115773-21-2, is an organic compound characterized by a benzene ring substituted with a propyl group and a bromoethyl group. This compound features a hydrophobic aromatic system due to the presence of the benzene ring, which contributes to its stability and unique reactivity. The bromoethyl substituent introduces a halogen, making the molecule potentially reactive in nucleophilic substitution reactions, while the propyl group enhances its hydrophobic character. The presence of these substituents can influence the compound's physical properties, such as boiling and melting points, as well as its solubility in various solvents. Additionally, the compound may exhibit specific biological activities or toxicological properties, depending on its structure and the functional groups present. As with many brominated compounds, it is essential to handle this substance with care due to potential environmental and health impacts associated with halogenated organic compounds.

Formula: C₁₁H₁₅Br

InChI: InChI=1S/C11H15Br/c1-3-4-10-5-7-11(8-6-10)9(2)12/h5-9H,3-4H2,1-2H3

InChI key: InChIKey=MHNNDAXVFACOCB-UHFFFAOYSA-N

SMILES: C(Br)(C)C1=CC=C(CCC)C=C1

Synonyms:

• Benzene, 1-(1-bromoethyl)-4-propyl-
• 1-(1-Bromoethyl)-4-propylbenzene