
CAS 115787-51-4
:5-(2-Chloroacetyl)-2-hydroxybenzaldehyde
Description:
5-(2-Chloroacetyl)-2-hydroxybenzaldehyde, with the CAS number 115787-51-4, is an organic compound characterized by its aromatic structure, which includes a hydroxyl group and an aldehyde functional group. This compound features a chloroacetyl substituent at the 5-position of the benzene ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its hydrogen bonding capabilities. As a derivative of salicylaldehyde, it exhibits properties typical of both aldehydes and phenolic compounds, making it useful in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its unique structure may also impart biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as the chloroacetyl group can be reactive and potentially hazardous. Overall, this compound serves as a valuable intermediate in the synthesis of more complex organic molecules.
Formula:C9H7ClO3
InChI:InChI=1S/C9H7ClO3/c10-4-9(13)6-1-2-8(12)7(3-6)5-11/h1-3,5,12H,4H2
InChI key:InChIKey=FSRMZXYUHOTEOH-UHFFFAOYSA-N
SMILES:C(CCl)(=O)C1=CC(C=O)=C(O)C=C1
Synonyms:- Benzaldehyde, 5-(chloroacetyl)-2-hydroxy-
- 5-(2-Chloroacetyl)-2-hydroxybenzaldehyde
- Benzaldehyde, 5-(2-chloroacetyl)-2-hydroxy-
- 5-(Chloroacetyl)-2-hydroxybenzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
