CAS 115797-06-3
:A-conotoxin si
Description:
A-conotoxin SI is a peptide derived from the venom of the Conus snail, specifically the species Conus striatus. This compound is classified as a conotoxin, which are small, disulfide-rich peptides that target various ion channels and receptors in the nervous system. A-conotoxin SI is known for its selective inhibition of nicotinic acetylcholine receptors, particularly those containing the α3 and β2 subunits, making it a valuable tool for studying synaptic transmission and potential therapeutic applications in pain management and neurological disorders. The structure of A-conotoxin SI features multiple disulfide bonds that contribute to its stability and biological activity. Its specificity and potency make it a subject of interest in pharmacological research, particularly in the development of novel analgesics. Additionally, due to its origin from marine organisms, A-conotoxin SI exemplifies the potential of natural products in drug discovery and the exploration of new therapeutic avenues.
Formula:C55H88N16O16S4
InChI:InChI=1/C55H88N16O16S4/c1-4-27(2)43(58)54(86)69-38(26-91)51(83)68-37(25-90)50(82)64-33(20-41(57)74)55(87)71-18-8-11-40(71)52(84)61-28(3)45(77)67-36(24-89)46(78)60-21-42(75)70-17-7-10-39(70)53(85)62-31(9-5-6-16-56)47(79)63-32(19-29-12-14-30(73)15-13-29)48(80)65-34(22-72)49(81)66-35(23-88)44(59)76/h12-15,27-28,31-40,43,72-73,88-91H,4-11,16-26,56,58H2,1-3H3,(H2,57,74)(H2,59,76)(H,60,78)(H,61,84)(H,62,85)(H,63,79)(H,64,82)(H,65,80)(H,66,81)(H,67,77)(H,68,83)(H,69,86)/t27-,28-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40?,43-/m0/s1
Synonyms:- a-Conotoxin SI, Conus striatus
- Alpha-Conotoxin Si
- 1-[(2S)-4-amino-2-[[(2R)-2-[[(2R)-2-[[(2S,3S)-2-amino-3-methyl-pentanoyl]amino]-3-sulfanyl-propanoyl]amino]-3-sulfanyl-propanoyl]amino]-4-oxo-butanoyl]-N-[(1S)-2-[[(1R)-2-[[2-[(2S)-2-[[(1S)-5-amino-1-[[(1S)-2-[[(1S)-2-[[(1R)-2-amino-2-oxo-1-(sulfanylmethyl)ethyl]amino]-1-(hydroxymethyl)-2-oxo-ethyl]amino]-1-[(4-hydroxyphenyl)methyl]-2-oxo-ethyl]carbamoyl]pentyl]carbamoyl]pyrrolidin-1-yl]-2-oxo-ethyl]amino]-2-oxo-1-(sulfanylmethyl)ethyl]amino]-1-methyl-2-oxo-ethyl]pyrrolidine-2-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Alpha-Conotoxin SI
CAS:Sourced from the marine snail, conus striatus, this synthetic cone snail toxin is a nicotinic acetylcholine receptor blocker. This product has disulfide bonds between Cys2-Cys7 and Cys3-Cys7.
Formula:C55H84N16O16S4Purity:Min. 95%Molecular weight:1,353.6 g/mol
