CAS 1158-80-1

3,12-bis(2-chloroethyl)-3,12-diaza-6,9-diazoniadispiro[5.2.5.2]hexadecane dichloride

Description:

3,12-bis(2-chloroethyl)-3,12-diaza-6,9-diazoniadispiro[5.2.5.2]hexadecane dichloride, with CAS number 1158-80-1, is a synthetic organic compound characterized by its complex structure, which includes multiple nitrogen atoms and a dispiro framework. This compound features two 2-chloroethyl groups, contributing to its reactivity and potential applications in medicinal chemistry, particularly as an alkylating agent. The presence of diaza groups indicates that it has a significant number of nitrogen atoms, which can influence its solubility and interaction with biological systems. The dichloride form suggests that it can exist as a salt, enhancing its stability and solubility in polar solvents. Due to its unique structure, this compound may exhibit interesting pharmacological properties, including potential antitumor activity. However, its reactivity also necessitates careful handling, as it may pose risks associated with alkylating agents, such as toxicity and mutagenicity. Overall, this compound represents a notable example of a complex nitrogen-containing heterocycle with potential applications in various fields of chemistry and pharmacology.

Formula: C₁₆H₃₂Cl₄N₄

InChI: InChI=1/C16H32Cl2N4.2ClH/c17-1-3-19-5-9-21(10-6-19)13-15-22(16-14-21)11-7-20(4-2-18)8-12-22;;/h1-16H2;2*1H/q+2;;/p-2

Synonyms:

• 3,12-Bis(2-chloroethyl)-3,6,9,12-tetraazadispiro[5.2.5(9).2(6)]Hexadecane-6,9-diium chloride
• 3,6,9,12-Tetraazadispiro[5.2.5.2]hexadecan-6,9-ium,3,12-bis(2-chloroethyl)-, chloride (1:2)
• Spirazidin