CAS 1158098-73-7
:2-Propanesulfinamide, 2-methyl-N-3-oxetanylidene-
Description:
2-Propanesulfinamide, 2-methyl-N-3-oxetanylidene- is a chemical compound characterized by its sulfinamide functional group, which features a sulfur atom bonded to both an amine and an alkyl group. This compound is notable for its unique structural features, including the presence of a 3-oxetanylidene moiety, which contributes to its potential reactivity and applications in organic synthesis. The presence of the methyl group enhances its steric properties, influencing its interactions in chemical reactions. As a sulfinamide, it may exhibit properties typical of both sulfonamides and amines, such as potential biological activity and the ability to participate in various chemical transformations. The compound's specific applications and reactivity would depend on its molecular structure and the functional groups present, making it of interest in fields such as medicinal chemistry and materials science. Further studies would be necessary to fully elucidate its properties and potential uses in various chemical contexts.
Formula:C7H13NO3S
InChI:InChI=1S/C7H13NO2S/c1-7(2,3)11(9)8-6-4-10-5-6/h4-5H2,1-3H3
SMILES:CC(C)(C)S(=O)N=C1COC1
Synonyms:- 2-Methyl-N-(oxetan-3-ylidene)propane-2-sulfinamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Methyl-N-(3-oxetanylidene)propane-2-sulfinamide, 95%
CAS:<p>It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuffs. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. T</p>Formula:C7H13NO2SPurity:95%Color and Shape:Yellow., Low melting point solid.Molecular weight:175.252-Propanesulfinamide, 2-methyl-N-3-oxetanylidene-
CAS:Formula:C7H13NO2SPurity:95%Color and Shape:LiquidMolecular weight:175.24862-Methyl-N-(oxetan-3-ylidene)propane-2-sulfinamide
CAS:<p>2-Methyl-N-(oxetan-3-ylidene)propane-2-sulfinamide</p>Purity:98%Color and Shape:Pale Yellow Low-Melting SolidMolecular weight:175.24862g/mol2-Methyl-N-(oxetan-3-ylidene)propane-2-sulfinamide
CAS:Formula:C7H13NO2SPurity:95%Color and Shape:LiquidMolecular weight:175.25



