CAS 115815-30-0
:3-benzyl-5-bromo-2-hydroxy-N-(4-nitrophenyl)benzamide - piperazine (1:1)
Description:
3-benzyl-5-bromo-2-hydroxy-N-(4-nitrophenyl)benzamide - piperazine (1:1), with CAS number 115815-30-0, is a chemical compound that exhibits a complex structure featuring both aromatic and aliphatic components. This compound contains a benzamide moiety, which is characterized by the presence of a benzene ring attached to a carbonyl group (amide), along with a piperazine ring, a six-membered cyclic amine known for its biological activity. The presence of a bromine atom and a nitrophenyl group introduces significant electronic effects, potentially enhancing the compound's reactivity and biological properties. The hydroxyl group contributes to its polarity, which may influence solubility and interaction with biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and biological activity, would require empirical investigation to fully understand its potential applications.
Formula:C24H25BrN4O4
InChI:InChI=1/C20H15BrN2O4.C4H10N2/c21-15-11-14(10-13-4-2-1-3-5-13)19(24)18(12-15)20(25)22-16-6-8-17(9-7-16)23(26)27;1-2-6-4-3-5-1/h1-9,11-12,24H,10H2,(H,22,25);5-6H,1-4H2
Synonyms:- Benzamide, 5-bromo-2-hydroxy-N-(4-nitrophenyl)-3-(phenylmethyl)-, compd. with piperazine (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzamide, 5-bromo-2-hydroxy-N-(4-nitrophenyl)-3-(phenylmethyl)-, compd. with piperazine (1:1) (9CI)
CAS:Formula:C24H25BrN4O4Molecular weight:513.3837
