CAS 115816-34-7

1-[1-(3-chlorophenyl)cyclobutyl]methanamine

Description:

1-[1-(3-chlorophenyl)cyclobutyl]methanamine, with the CAS number 115816-34-7, is a chemical compound characterized by its unique structural features. It consists of a cyclobutyl group attached to a methanamine moiety, with a 3-chlorophenyl substituent. This compound exhibits properties typical of amines, including the potential for hydrogen bonding due to the presence of the amine functional group. The chlorophenyl group may influence its reactivity and solubility, potentially enhancing lipophilicity and biological activity. The cyclobutyl ring contributes to the compound's three-dimensional conformation, which can affect its interaction with biological targets. As a result, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 1-[1-(3-chlorophenyl)cyclobutyl]methanamine represents a complex organic molecule with potential significance in various chemical and biological contexts.

Formula: C₁₁H₁₄ClN

InChI: InChI=1/C11H14ClN/c12-10-4-1-3-9(7-10)11(8-13)5-2-6-11/h1,3-4,7H,2,5-6,8,13H2

SMILES: c1cc(cc(c1)Cl)C1(CCC1)CN

Synonyms:

• cyclobutanemethanamine, 1-(3-chlorophenyl)-1-(3-Chlorophenyl)-cyclobutanemethanamine
• 1-[1-(3-Chlorophenyl)cyclobutyl]methanamine

Cyclobutanemethanamine, 1-(3-chlorophenyl)-

CAS: 115816-34-7

Formula: C₁₁H₁₄ClN

Purity: 95%

Color and Shape: Liquid

Molecular weight: 195.6886

Ref: IN-DA000GX0

1-(3-Chlorophenyl)-cyclobutanemethanamine

CAS: 115816-34-7

1-(3-Chlorophenyl)-cyclobutanemethanamine

Molecular weight: 195.69g/mol

Ref: 54-OR451128

(1-(3-Chlorophenyl)cyclobutyl)methanamine

CAS: 115816-34-7

Purity: 90%

Molecular weight: 195.6900024

Ref: 10-F637460