CAS 115819-92-6

2-Piperidinecarboxylicacid,1-hydroxy-(9CI)

Description:

2-Piperidinecarboxylic acid, 1-hydroxy- (9CI), with the CAS number 115819-92-6, is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a carboxylic acid functional group and a hydroxyl group, contributing to its acidic and potentially polar nature. The presence of these functional groups suggests that it may exhibit both acidic and basic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. Additionally, the compound's structure may influence its solubility in polar solvents, making it more soluble in water compared to non-polar solvents. Its potential applications could span across pharmaceuticals, where it may serve as an intermediate in the synthesis of biologically active compounds, or in materials science. Overall, the unique combination of functional groups and the piperidine framework provides this compound with interesting chemical reactivity and potential utility in various fields.

Formula: C₆H₁₁NO₃

InChI: InChI=1S/C6H11NO3/c8-6(9)5-3-1-2-4-7(5)10/h5,10H,1-4H2,(H,8,9)

InChI key: SEWARTPIJFHCRP-UHFFFAOYSA-N

SMILES: C1CCN(C(C1)C(=O)O)O

1-HYDROXY-2-PIPERIDINECARBOXYLIC ACID

CAS: 115819-92-6

Purity: 98%

Ref: IN-DA009UVT

N-Hydroxypipecolic acid

CAS: 115819-92-6

N-Hydroxypipecolic acid

Formula: C₆H₁₁NO₃

Purity: ≥95%

Molecular weight: 145.16

Ref: 54-BUP14417

N-Hydroxypipecolic acid

CAS: 115819-92-6

N-Hydroxypipecolic acid (NHP) is a plant metabolite and a systemic acquired resistance (SAR) regulator.

Formula: C₆H₁₁NO₃

Purity: 98.23% - ≥95%

Color and Shape: Yellow Solid

Molecular weight: 145.16

Ref: TM-T19458

N-Hydroxypipecolic acid

CAS: 115819-92-6

1-Hydroxypiperidine-2-carboxylic acid

Formula: C₆H₁₁NO₃

Purity: 98%

Molecular weight: 145.16

Ref: IN-DG520214