CAS 115826-95-4
:[(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride
Description:
[(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride, commonly referred to as BINAP-Pd(II) chloride, is a coordination complex featuring palladium as the central metal ion coordinated to a chiral ligand. This compound is characterized by its bidentate ligand structure, where the BINAP moiety provides two diphenylphosphine groups that facilitate strong coordination to the palladium center. The chirality of the BINAP ligand imparts unique stereochemical properties, making it valuable in asymmetric catalysis, particularly in reactions such as cross-coupling and hydrogenation. The palladium(II) oxidation state is significant for its catalytic activity, allowing it to participate in various organic transformations. The compound is typically a solid at room temperature and is soluble in organic solvents, which enhances its utility in synthetic applications. Its reactivity and selectivity in catalysis are influenced by the steric and electronic properties of the BINAP ligand, making it a prominent choice in the field of organometallic chemistry and catalysis.
Formula:C44H32Cl2P2Pd
InChI:InChI=1/C44H32P2.2ClH.Pd/c1-5-19-35(20-6-1)45(36-21-7-2-8-22-36)41-31-29-33-17-13-15-27-39(33)43(41)44-40-28-16-14-18-34(40)30-32-42(44)46(37-23-9-3-10-24-37)38-25-11-4-12-26-38;;;/h1-32H;2*1H;/q;;;+2/p-2
SMILES:c1ccc(cc1)P(c1ccccc1)c1ccc2ccccc2c1c1c2ccccc2ccc1P(c1ccccc1)c1ccccc1.Cl.Cl.[Pd]
Synonyms:- Dichloro[(S)-(-)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II)
- 1,1'-Binaphthalene-2,2'-Diylbis(Diphenylphosphane)-Dichloropalladium (1:1)
- Dichloro[(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride
- [(R)-(+)-2,2'-Bis(Diphenylphosphino)-1,1'-Binaphthyl]Palladium(Ii) Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dichloro[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II), min. 98%
CAS:<p>Dichloro[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II), min. 98%</p>Formula:PdCl2(C44H32P2)Purity:min. 98%Color and Shape:orange microxtls.Molecular weight:800.00[(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride
CAS:Formula:C44H32Cl2P2PdPurity:98%Color and Shape:SolidMolecular weight:799.9984[(R)-(+)-2,2’-Bis(Diphenylphosphino)-1,1’-Binaphthyl]Palladium(II) Chloride
CAS:[(R)-(+)-2,2’-Bis(Diphenylphosphino)-1,1’-Binaphthyl]Palladium(II) ChloridePurity:98%Molecular weight:800.01g/mol((R)-2,2′-Bis(diphenylphosphino)-1,1′-binaphthyl)dichloropalladium
CAS:Purity:98%Molecular weight:798.04(R)-(+)-(2,2-Bis(Diphenylphosphino)-1,1-binaphthyl)palladium(II)chloride
CAS:Controlled Product<p>(R)-(+)-(2,2-Bis(Diphenylphosphino)-1,1-binaphthyl)palladium(II)chloride is a colorless solid that can be made into a crystalline form. It has a molecular weight of 518.8 g/mol and the chemical formula C12H14P4Cl2. The compound has four asymmetric carbon atoms and two stereocenters in the molecule. This compound is used as a catalyst for organic reactions and in the synthesis of other compounds. (R)-(+)-(2,2-Bis(Diphenylphosphino)-1,1-binaphthyl)palladium(II)chloride is soluble in ethanol and ether but insoluble in water. It reacts with oxygen to produce phosphorous acid and hydrogen chloride gas. This compound has been shown to have nuclear magnetic resonance spectra at room temperature with chemical shifts (</p>Formula:C44H33Cl2P2PdPurity:Min. 95%Molecular weight:801.01 g/mol





