CAS 1158269-27-2

1H-Imidazole, 1-(2-chloroethyl)-2-ethyl-, hydrochloride (1:1)

Description:

1H-Imidazole, 1-(2-chloroethyl)-2-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a chloroethyl substituent, which enhances its reactivity and potential biological activity. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, which typically improves the solubility of the compound in water and other polar solvents. The molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs due to the imidazole moiety's role in biological systems, including its involvement in enzyme catalysis and as a building block for various bioactive molecules. Additionally, the chloroethyl group may impart alkylating properties, which can be significant in medicinal chemistry. Overall, this compound's characteristics make it of interest in both synthetic and medicinal chemistry contexts, although specific applications would depend on further research and testing.

Formula: C₇H₁₁ClN₂·ClH

InChI: InChI=1S/C7H11ClN2.ClH/c1-2-7-9-4-6-10(7)5-3-8;/h4,6H,2-3,5H2,1H3;1H

InChI key: InChIKey=VOFQBWCNJRXGPN-UHFFFAOYSA-N

SMILES: C(CCl)N1C(CC)=NC=C1.Cl

Synonyms:

• 1H-Imidazole, 1-(2-chloroethyl)-2-ethyl-, hydrochloride (1:1)