CAS 1158378-96-1

Methanone, (3-amino-1-piperidinyl)(4-chlorophenyl)-, hydrochloride (1:1)

Description:

Methanone, (3-amino-1-piperidinyl)(4-chlorophenyl)-, hydrochloride (1:1), also known by its CAS number 1158378-96-1, is a chemical compound characterized by its piperidine and chlorophenyl moieties. This substance features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, contributing to its potential biological activity. The presence of the amino group enhances its solubility and reactivity, while the chlorophenyl group may influence its pharmacological properties. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, particularly in medicinal chemistry. The compound may exhibit properties relevant to drug development, potentially acting as a ligand or inhibitor in biological systems. Its specific interactions and effects would depend on the context of its use, including dosage and formulation. Safety and handling precautions should be observed, as with any chemical substance, particularly those with biological activity. Further research would be necessary to fully elucidate its characteristics and potential applications.

Formula: C₁₂H₁₅ClN₂O·ClH

InChI: InChI=1S/C12H15ClN2O.ClH/c13-10-5-3-9(4-6-10)12(16)15-7-1-2-11(14)8-15;/h3-6,11H,1-2,7-8,14H2;1H

InChI key: InChIKey=BPALJZWKIMIRED-UHFFFAOYSA-N

SMILES: C(=O)(N1CC(N)CCC1)C2=CC=C(Cl)C=C2.Cl

Synonyms:

• Methanone, (3-amino-1-piperidinyl)(4-chlorophenyl)-, hydrochloride (1:1)