CymitQuimica logo

CAS 115843-99-7

:

4-BROMO-3-CHLORO-2-FLUOROANILINE

Description:
4-Bromo-3-chloro-2-fluoroaniline is an organic compound that belongs to the class of anilines, which are aromatic amines characterized by the presence of an amino group (-NH2) attached to a benzene ring. This particular compound features three halogen substituents: a bromine atom at the para position, a chlorine atom at the meta position, and a fluorine atom at the ortho position relative to the amino group. These halogen substituents significantly influence the compound's chemical reactivity, polarity, and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of multiple halogens can enhance the compound's biological activity and alter its solubility in different solvents. Additionally, 4-bromo-3-chloro-2-fluoroaniline may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns associated with halogenated organic compounds.
Formula:C6H4BrClFN
InChI:InChI=1/C6H4BrClFN/c7-3-1-2-4(10)6(9)5(3)8/h1-2H,10H2
InChI key:WYXZIQDHENNEPU-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1Br)Cl)F)N
Synonyms:
  • Buttpark 89\07-45
Found 5 products.