CAS 1158568-96-7

Benzenemethanamine, 4-fluoro-N-(3-methoxypropyl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-fluoro-N-(3-methoxypropyl)-, hydrochloride (1:1), commonly referred to as a substituted phenethylamine, is a chemical compound characterized by its amine functional group and a fluorine atom attached to the benzene ring. The presence of the methoxypropyl group enhances its solubility and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound may exhibit properties such as psychoactivity or pharmacological effects, depending on its specific structure and substituents. Its molecular interactions can be influenced by the electron-withdrawing nature of the fluorine atom and the steric effects of the methoxypropyl group. Safety and handling precautions are essential, as with many amines, due to potential toxicity or reactivity. Research into its applications may include areas such as medicinal chemistry, where it could serve as a lead compound for drug development or as a research tool in neuropharmacology.

Formula: C₁₁H₁₆FNO·ClH

InChI: InChI=1S/C11H16FNO.ClH/c1-14-8-2-7-13-9-10-3-5-11(12)6-4-10;/h3-6,13H,2,7-9H2,1H3;1H

InChI key: InChIKey=AXCUGBJCBWUJFH-UHFFFAOYSA-N

SMILES: C(NCCCOC)C1=CC=C(F)C=C1.Cl

Synonyms:

• Benzenemethanamine, 4-fluoro-N-(3-methoxypropyl)-, hydrochloride (1:1)