CAS 115864-73-8
:2-Ethyl-3-hydroxy-1-methyl-4(1H)-pyridinone
Description:
2-Ethyl-3-hydroxy-1-methyl-4(1H)-pyridinone, with the CAS number 115864-73-8, is an organic compound characterized by its pyridinone structure, which features a hydroxyl group and an ethyl side chain. This compound is known for its chelating properties, particularly in forming complexes with metal ions, which can be significant in various biochemical and industrial applications. The presence of the hydroxyl group enhances its solubility in polar solvents, while the ethyl and methyl groups contribute to its hydrophobic characteristics. This compound may exhibit biological activity, including potential antioxidant properties, making it of interest in pharmaceutical research. Additionally, its structural features suggest that it could participate in various chemical reactions, including those involving coordination chemistry. Overall, 2-Ethyl-3-hydroxy-1-methyl-4(1H)-pyridinone is a versatile compound with potential applications in both medicinal chemistry and materials science.
Formula:C8H11NO2
InChI:InChI=1S/C8H11NO2/c1-3-6-8(11)7(10)4-5-9(6)2/h4-5,11H,3H2,1-2H3
InChI key:InChIKey=YHUAHVPZGNXPMS-UHFFFAOYSA-N
SMILES:C(C)C1=C(O)C(=O)C=CN1C
Synonyms:- 2-ethyl-3-hydroxy-1-methylpyridin-4(1H)-one
- 2-Ethyl-3-hydroxy-1-methyl-4(1H)-pyridinone
- 1-Methyl-2-ethyl-3-hydroxypyridin-4-one
- CP 93
- 2-Ethyl-3-hydroxy-1-methyl-4(1H)-pyridinone
- 4(1H)-Pyridinone, 2-ethyl-3-hydroxy-1-methyl-
- 1-Methyl-2-ethyl-3-hydroxypyrid-4-one
- CP93
- 4(1H)-Pyridinone, 2-ethyl-3-hydroxy-1-methyl-
- 2-Ethyl-3-hydroxy-1-methylpyridin-4(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.


