CAS 1158680-89-7: 7-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole

Description: 7-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole is a chemical compound characterized by its unique structural features, which include a bromine atom and a tetrahydro-pyran moiety attached to an indazole core. The presence of the bromine atom typically imparts increased reactivity and can influence the compound's biological activity. The tetrahydro-2H-pyran group contributes to the compound's overall stability and solubility, making it potentially useful in various chemical reactions and applications. Indazoles are known for their diverse pharmacological properties, including anti-inflammatory and anticancer activities, which may be relevant for this compound as well. The molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, affecting its behavior in biological systems. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, and its properties can be further explored through spectroscopic methods. Overall, 7-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole represents a compound of interest in medicinal chemistry and drug development.

Formula: C₁₂H₁₃BrN₂O

InChI: InChI=1S/C12H13BrN2O/c13-10-5-3-4-9-8-14-15(12(9)10)11-6-1-2-7-16-11/h3-5,8,11H,1-2,6-7H2

InChI key: InChIKey=GDUNQMVBIWXPEQ-UHFFFAOYSA-N

SMILES: BrC1=CC=CC=2C=NN(C12)C3OCCCC3

Synonyms:

• 7-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole
• 1H-Indazole, 7-bromo-1-(tetrahydro-2H-pyran-2-yl)-

7-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole

CAS: 1158680-89-7

• Purity: 0.95
• Molecular weight: 281.15g/mol

7-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole

CAS: 1158680-89-7

• Molecular weight: 281.153

7-Bromo-1-(oxan-2-yl)-1H-indazole

CAS: 1158680-89-7

Versatile small molecule scaffold

• Formula: C₁₂H₁₃BrN₂O
• Purity: Min. 95%
• Molecular weight: 281.15 g/mol