
CAS 1158680-97-7
:1-[3-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-1-yl]ethanone
Description:
1-[3-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-1-yl]ethanone, with the CAS number 1158680-97-7, is a synthetic organic compound characterized by its complex structure, which includes an indazole moiety and a dioxaborolane group. The presence of the dioxaborolane unit suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions and as a reagent in organic synthesis. The indazole ring contributes to the compound's aromaticity and may influence its electronic properties, making it of interest in medicinal chemistry and material science. The compound's molecular structure indicates it may exhibit specific reactivity patterns, including potential interactions with biological targets or participation in polymerization processes. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular architecture. As with many synthetic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C16H21BN2O3
InChI:InChI=1S/C16H21BN2O3/c1-10-13-9-12(7-8-14(13)19(18-10)11(2)20)17-21-15(3,4)16(5,6)22-17/h7-9H,1-6H3
InChI key:InChIKey=DHYSFIBCSKKIMB-UHFFFAOYSA-N
SMILES:C(C)(=O)N1C=2C(=CC(=CC2)B3OC(C)(C)C(C)(C)O3)C(C)=N1
Synonyms:- 1-[3-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-1-yl]ethanone
- Ethanone, 1-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-1-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[3-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-1-yl]ethanone
CAS:Formula:C16H21BN2O3Molecular weight:300.1605
