CAS 1158736-02-7: β-Methyl-1H-1,2,4-triazole-1-ethanol
Description:β-Methyl-1H-1,2,4-triazole-1-ethanol is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a methyl group at the β-position and an ethanol functional group, contributing to its solubility and reactivity. It is typically a white to off-white solid or a liquid, depending on its form and purity. The presence of the hydroxyl (-OH) group in the ethanol moiety enhances its potential for hydrogen bonding, which can influence its physical properties and interactions with other molecules. β-Methyl-1H-1,2,4-triazole-1-ethanol may exhibit biological activity, making it of interest in pharmaceutical and agricultural applications, particularly as a potential fungicide or in the development of agrochemicals. Its specific properties, such as melting point, boiling point, and solubility, would depend on the conditions and purity of the sample. As with any chemical, proper handling and safety measures should be observed due to potential hazards associated with its use.
Formula:C5H9N3O
InChI:InChI=1S/C5H9N3O/c1-5(2-9)8-4-6-3-7-8/h3-5,9H,2H2,1H3
InChI key:InChIKey=DOCGNFWFMFMJGR-UHFFFAOYSA-N
SMILES:OCC(N1N=CN=C1)C
- Synonyms:
- β-Methyl-1H-1,2,4-triazole-1-ethanol
- 2-(1,2,4-Triazol-1-yl)propan-1-ol
- 2-(1H-1,2,4-Triazol-1-yl)-1-propanol
- 2-(1H-1,2,4-Triazol-1-yl)propan-1-ol
- 1H-1,2,4-Triazole-1-ethanol, β-methyl-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1H-1,2,4-triazole-1-ethanol, β-methyl- REF: IN-DA008V6QCAS: 1158736-02-7 | - - - | To inquire | Mon 03 Mar 25 |
 | 2-(1H-1,2,4-Triazol-1-yl)propan-1-ol REF: TR-H954003CAS: 1158736-02-7 | - - - | 92.00 €~222.00 € | Fri 11 Apr 25 |
 | 2-(1H-1,2,4-triazol-1-yl)-1-propanol REF: 10-F311654CAS: 1158736-02-7 | 95.0% | - - - | Discontinued product |
 | 2-(1H-1,2,4-Triazol-1-yl)propan-1-ol REF: 3D-FT121920CAS: 1158736-02-7 | Min. 95% | - - - | Discontinued product |
1H-1,2,4-triazole-1-ethanol, β-methyl-
Ref: IN-DA008V6Q
| Undefined size | To inquire |
2-(1H-1,2,4-Triazol-1-yl)propan-1-ol
Controlled ProductRef: TR-H954003
| 50mg | 92.00 € | ||
| 100mg | 129.00 € | ||
| 500mg | 222.00 € |
Ref: 10-F311654
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
2-(1H-1,2,4-Triazol-1-yl)propan-1-ol
Ref: 3D-FT121920
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
