CAS 1158745-53-9

1,1-Dimethylethyl 5-amino-2,3-dihydro-3,3-dimethyl-1H-indole-1-carboxylate

Description:

1,1-Dimethylethyl 5-amino-2,3-dihydro-3,3-dimethyl-1H-indole-1-carboxylate, identified by its CAS number 1158745-53-9, is a chemical compound that belongs to the class of indole derivatives. This substance features a complex structure characterized by an indole ring, which is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. The presence of the dimethyl and amino groups contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The ester functional group indicated by "carboxylate" suggests that it may exhibit characteristics typical of esters, such as being less polar than acids and potentially having distinct solubility properties. The compound's structural features may also suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Overall, this compound exemplifies the diversity of organic chemistry and the potential for complex molecular interactions.

Formula: C₁₅H₂₂N₂O₂

InChI: InChI=1S/C15H22N2O2/c1-14(2,3)19-13(18)17-9-15(4,5)11-8-10(16)6-7-12(11)17/h6-8H,9,16H2,1-5H3

InChI key: InChIKey=JGZBEJFXXUVMNV-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C=2C(C(C)(C)C1)=CC(N)=CC2

Synonyms:

• 1H-Indole-1-carboxylic acid, 5-amino-2,3-dihydro-3,3-dimethyl-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 5-amino-2,3-dihydro-3,3-dimethyl-1H-indole-1-carboxylate