CAS 1158749-45-1
:6-Ethenylbenzothiazole
Description:
6-Ethenylbenzothiazole is an organic compound characterized by its unique structure, which includes a benzothiazole moiety with an ethenyl group attached. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and stability. Benzothiazoles are known for their applications in various fields, including pharmaceuticals, agrochemicals, and materials science, due to their biological activity and ability to form coordination complexes. The ethenyl group enhances the compound's reactivity, making it suitable for further chemical modifications or polymerization processes. Additionally, compounds like 6-ethenylbenzothiazole may exhibit fluorescence, which can be advantageous in applications such as sensors or dyes. Its solubility and stability in different solvents can vary, influencing its practical applications. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the specific characteristics can impact its use in industrial or laboratory settings. Overall, 6-ethenylbenzothiazole represents a versatile compound with potential utility in various chemical applications.
Formula:C9H7NS
InChI:InChI=1S/C9H7NS/c1-2-7-3-4-8-9(5-7)11-6-10-8/h2-6H,1H2
InChI key:InChIKey=KHPUDVBMCPZAQV-UHFFFAOYSA-N
SMILES:C(=C)C=1C=C2C(=CC1)N=CS2
Synonyms:- 6-Ethenylbenzothiazole
- Benzothiazole, 6-ethenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
