CymitQuimica logo

CAS 1158750-07-2

:

3-Pyridinemethanamine, N-[2-(1-cyclohexen-1-yl)ethyl]-, hydrochloride (1:1)

Description:
3-Pyridinemethanamine, N-[2-(1-cyclohexen-1-yl)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which contributes to its basicity and potential for forming hydrogen bonds. The presence of the cyclohexenyl group introduces a degree of unsaturation and steric hindrance, influencing its reactivity and interaction with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as being a potential ligand in coordination chemistry or a precursor in organic synthesis. Its molecular structure suggests possible applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. Additionally, the presence of the amine functional group indicates potential for further derivatization, allowing for the exploration of structure-activity relationships in drug design. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C14H20N2·ClH
InChI:InChI=1S/C14H20N2.ClH/c1-2-5-13(6-3-1)8-10-16-12-14-7-4-9-15-11-14;/h4-5,7,9,11,16H,1-3,6,8,10,12H2;1H
InChI key:InChIKey=IPTRTZJILVGXBT-UHFFFAOYSA-N
SMILES:C(CNCC=1C=CC=NC1)C=2CCCCC2.Cl
Synonyms:
  • 3-Pyridinemethanamine, N-[2-(1-cyclohexen-1-yl)ethyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.