CymitQuimica logo

CAS 1158750-30-1

:

1-(Phenylmethyl)-1,8-diazaspiro[5.5]undecane

Description:
1-(Phenylmethyl)-1,8-diazaspiro[5.5]undecane is a chemical compound characterized by its unique spirocyclic structure, which features a combination of nitrogen atoms and a phenylmethyl group. This compound belongs to a class of spiro compounds, which are known for their distinctive ring systems that can influence their chemical reactivity and biological activity. The presence of two nitrogen atoms in the structure contributes to its potential as a ligand in coordination chemistry and may also impart specific pharmacological properties. The phenylmethyl group enhances the lipophilicity of the molecule, potentially affecting its solubility and interaction with biological membranes. Additionally, the compound's stereochemistry can play a significant role in its biological activity, making it of interest in medicinal chemistry. Overall, 1-(Phenylmethyl)-1,8-diazaspiro[5.5]undecane presents a fascinating subject for research due to its structural complexity and potential applications in various fields, including drug development and materials science.
Formula:C16H24N2
InChI:InChI=1S/C16H24N2/c1-2-7-15(8-3-1)13-18-12-5-4-9-16(18)10-6-11-17-14-16/h1-3,7-8,17H,4-6,9-14H2
InChI key:InChIKey=VQYUWELHBRODQT-UHFFFAOYSA-N
SMILES:C(N1C2(CCCC1)CCCNC2)C3=CC=CC=C3
Synonyms:
  • 1-(Phenylmethyl)-1,8-diazaspiro[5.5]undecane
  • 1,8-Diazaspiro[5.5]undecane, 1-(phenylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.