CAS 1158750-52-7

1-Methyl-1,8-diazaspiro[5.5]undecane

Description:

1-Methyl-1,8-diazaspiro[5.5]undecane is a bicyclic organic compound characterized by its unique spiro structure, which consists of two interconnected rings sharing a single atom. This compound features two nitrogen atoms incorporated into its framework, contributing to its diaza designation. The presence of the methyl group at the nitrogen atom enhances its stability and influences its reactivity. Typically, compounds of this nature exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The spiro configuration can lead to distinct three-dimensional conformations, which may affect biological interactions and solubility. Additionally, the compound's molecular structure suggests potential applications in drug design and development, particularly in creating novel therapeutic agents. Its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, 1-Methyl-1,8-diazaspiro[5.5]undecane represents a fascinating area of study within the realm of heterocyclic chemistry and its applications in various fields.

Formula: C₁₀H₂₀N₂

InChI: InChI=1S/C10H20N2/c1-12-8-3-2-5-10(12)6-4-7-11-9-10/h11H,2-9H2,1H3

InChI key: InChIKey=IZWMIDJXRXVGHX-UHFFFAOYSA-N

SMILES: CN1C2(CCCNC2)CCCC1

Synonyms:

• 1,8-Diazaspiro[5.5]undecane, 1-methyl-
• 1-Methyl-1,8-diazaspiro[5.5]undecane