CAS 1158750-89-0: 2,7-Diazaspiro[4.5]decan-3-one

Description:2,7-Diazaspiro[4.5]decan-3-one is a bicyclic compound characterized by its unique spiro structure, which consists of two rings sharing a single atom. This compound features two nitrogen atoms incorporated into its framework, contributing to its diaza designation. The presence of a carbonyl group (C=O) at the 3-position is significant, as it influences the compound's reactivity and potential applications in organic synthesis. The spirocyclic nature of 2,7-Diazaspiro[4.5]decan-3-one imparts distinctive steric and electronic properties, making it of interest in medicinal chemistry and material science. Its structural features may facilitate interactions with biological targets, suggesting potential pharmacological activities. Additionally, the compound's solubility, stability, and reactivity can vary based on the surrounding environment, including factors such as pH and solvent polarity. Overall, 2,7-Diazaspiro[4.5]decan-3-one represents a fascinating subject for further research, particularly in the development of novel therapeutic agents or functional materials.

Formula:C₈H₁₄N₂O

InChI:InChI=1S/C8H14N2O/c11-7-4-8(6-10-7)2-1-3-9-5-8/h9H,1-6H2,(H,10,11)

InChI key:InChIKey=BBJZOKHHRARXIG-UHFFFAOYSA-N

SMILES:O=C1NCC2(CNCCC2)C1

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2,7-Diazaspiro[4.5]decan-3-one REF: IN-DA000H01CAS: 1158750-89-0	95%	To inquire	Tue 04 Mar 25
2,7-Diazaspiro[4.5]decan-3-one REF: 10-F230007CAS: 1158750-89-0	95.0%	110.00 €~1,349.00 €	Wed 05 Mar 25
2,7-Diazaspiro[4.5]decan-3-one REF: 54-OR917833CAS: 1158750-89-0	95+%	136.00 €~2,368.00 €	Tue 11 Mar 25
2,7-Diazaspiro[4.5]decan-3-one REF: 3D-IWB75089CAS: 1158750-89-0	Min. 95%	To inquire	Tue 15 Apr 25