CAS 1158750-91-4

1,1-Dimethylethyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate

Description:

1,1-Dimethylethyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate, with the CAS number 1158750-91-4, is a chemical compound characterized by its unique spirocyclic structure, which includes a diazabicyclic framework. This compound features a carboxylate functional group and a ketone, contributing to its reactivity and potential applications in organic synthesis. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric properties, which may influence its interactions in biological systems or chemical reactions. The spiro structure indicates that it has a rigid conformation, which can affect its physical properties, such as solubility and melting point. Additionally, the nitrogen atoms in the diaza moiety can participate in hydrogen bonding, potentially impacting its biological activity and solubility in polar solvents. Overall, this compound may be of interest in medicinal chemistry and materials science due to its structural features and potential reactivity.

Formula: C₁₃H₂₂N₂O₃

InChI: InChI=1S/C13H22N2O3/c1-12(2,3)18-11(17)15-6-4-5-13(9-15)7-10(16)14-8-13/h4-9H2,1-3H3,(H,14,16)

InChI key: InChIKey=TXCCTNIYGSOUBI-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC2(CNC(=O)C2)CCC1

Synonyms:

• 2,7-Diazaspiro[4.5]decane-7-carboxylic acid, 3-oxo-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate

tert-Butyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate

CAS: 1158750-91-4

Formula: C₁₃H₂₂N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 254.3254

Ref: IN-DA000H00

tert-Butyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate

CAS: 1158750-91-4

tert-Butyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate

Purity: 97%

Molecular weight: 254.33g/mol

Ref: 54-OR82489

tert-Butyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate

CAS: 1158750-91-4

Formula: C₁₃H₂₂N₂O₃

Purity: 97%

Molecular weight: 254.33

Ref: 10-F337318