CymitQuimica logo

CAS 1158755-29-3

:

7-Ethynylisoquinoline

Description:
7-Ethynylisoquinoline is a chemical compound characterized by its isoquinoline backbone, which is a bicyclic structure consisting of a benzene ring fused to a pyridine ring. The presence of an ethynyl group at the 7-position introduces a triple bond, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a solid at room temperature and may exhibit properties such as fluorescence, making it of interest in various fields, including materials science and drug development. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic purposes. Additionally, 7-Ethynylisoquinoline may participate in various chemical reactions, such as cross-coupling and cycloaddition, due to the presence of the ethynyl group. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if not managed properly. Overall, 7-Ethynylisoquinoline represents a versatile scaffold in organic chemistry with promising applications.
Formula:C11H7N
InChI:InChI=1S/C11H7N/c1-2-9-3-4-10-5-6-12-8-11(10)7-9/h1,3-8H
InChI key:InChIKey=OYXQUTRYPRKHRX-UHFFFAOYSA-N
SMILES:C(#C)C1=CC2=C(C=C1)C=CN=C2
Synonyms:
  • 7-Ethynylisoquinoline
  • Isoquinoline, 7-ethynyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.