CAS 1158759-12-6

Phenylmethyl N-(3-methyl-3-piperidinyl)carbamate

Description:

Phenylmethyl N-(3-methyl-3-piperidinyl)carbamate, identified by its CAS number 1158759-12-6, is a chemical compound that belongs to the class of carbamates. This substance typically exhibits characteristics common to carbamate derivatives, such as the presence of a carbamate functional group (-NH-CO-O-), which is known for its role in various biological activities and applications in medicinal chemistry. The compound features a phenylmethyl group, which contributes to its lipophilicity, potentially enhancing its ability to cross biological membranes. The presence of a piperidine ring, specifically substituted with a methyl group, suggests that it may interact with biological targets, possibly influencing neurotransmitter systems. Its structural attributes may confer specific pharmacological properties, making it of interest in drug development. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₄H₂₀N₂O₂

InChI: InChI=1S/C14H20N2O2/c1-14(8-5-9-15-11-14)16-13(17)18-10-12-6-3-2-4-7-12/h2-4,6-7,15H,5,8-11H2,1H3,(H,16,17)

InChI key: InChIKey=ZPCVHIWLFMTOSY-UHFFFAOYSA-N

SMILES: N(C(OCC1=CC=CC=C1)=O)C2(C)CCCNC2

Synonyms:

• Phenylmethyl N-(3-methyl-3-piperidinyl)carbamate
• Carbamic acid, N-(3-methyl-3-piperidinyl)-, phenylmethyl ester