
CAS 1158759-93-3
:4-Ethyltetrahydro-2H-pyran-4-ethanamine
Description:
4-Ethyltetrahydro-2H-pyran-4-ethanamine, identified by its CAS number 1158759-93-3, is a chemical compound that belongs to the class of amines and cyclic ethers. This substance features a tetrahydropyran ring, which is a six-membered saturated heterocyclic compound containing one oxygen atom. The presence of an ethyl group and an ethanamine functional group contributes to its unique properties. Typically, compounds of this nature exhibit moderate polarity due to the presence of both hydrophobic (ethyl and ethylamine) and hydrophilic (ether and amine) components. This dual nature can influence solubility in various solvents, making it potentially useful in organic synthesis and pharmaceutical applications. Additionally, the amine group may participate in hydrogen bonding, affecting the compound's reactivity and interaction with biological systems. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 4-Ethyltetrahydro-2H-pyran-4-ethanamine represents a versatile structure with implications in chemical research and development.
Formula:C9H19NO
InChI:InChI=1S/C9H19NO/c1-2-9(3-6-10)4-7-11-8-5-9/h2-8,10H2,1H3
InChI key:InChIKey=CLFSVDFRRLOSQQ-UHFFFAOYSA-N
SMILES:C(CN)C1(CC)CCOCC1
Synonyms:- 2H-Pyran-4-ethanamine, 4-ethyltetrahydro-
- 4-Ethyltetrahydro-2H-pyran-4-ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.