CAS 1158760-04-3

4-Piperidinamine, 1-[(4-fluorophenyl)methyl]-, hydrochloride (1:1)

Description:

4-Piperidinamine, 1-[(4-fluorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, which can influence the compound's biological activity and lipophilicity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in drug synthesis or having specific pharmacological effects, although detailed biological activity would depend on further studies. Its molecular structure suggests it could interact with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₂H₁₇FN₂·ClH

InChI: InChI=1S/C12H17FN2.ClH/c13-11-3-1-10(2-4-11)9-15-7-5-12(14)6-8-15;/h1-4,12H,5-9,14H2;1H

InChI key: InChIKey=RUOUASLQMJKNNA-UHFFFAOYSA-N

SMILES: C(C1=CC=C(F)C=C1)N2CCC(N)CC2.Cl

Synonyms:

• 4-Piperidinamine, 1-[(4-fluorophenyl)methyl]-, hydrochloride (1:1)

1-(4-Fluorobenzyl)piperidin-4-amine hydrochloride

CAS: 1158760-04-3

Formula: C₁₂H₁₈ClFN₂

Color and Shape: Solid

Molecular weight: 244.7361

Ref: IN-DA019FXZ