CAS 1158760-31-6

3-Ethyltetrahydro-3-furanmethanamine

Description:

3-Ethyltetrahydro-3-furanmethanamine is a chemical compound characterized by its unique structure, which includes a furan ring and an amine functional group. This compound features a tetrahydrofuran moiety, indicating it is a saturated derivative of furan, contributing to its stability and solubility in various organic solvents. The presence of the ethyl group enhances its hydrophobic characteristics, potentially influencing its reactivity and interaction with biological systems. As an amine, it can participate in hydrogen bonding and may act as a nucleophile in chemical reactions. The compound's specific properties, such as boiling point, melting point, and reactivity, would depend on its molecular interactions and the surrounding environment. It is important to note that detailed safety and handling information should be consulted, as amines can exhibit varying degrees of toxicity and reactivity. Overall, 3-Ethyltetrahydro-3-furanmethanamine represents a class of compounds with potential applications in pharmaceuticals and organic synthesis, although specific applications would require further investigation.

Formula: C₇H₁₅NO

InChI: InChI=1S/C7H15NO/c1-2-7(5-8)3-4-9-6-7/h2-6,8H2,1H3

InChI key: InChIKey=PFXSONMLECXXAE-UHFFFAOYSA-N

SMILES: C(C)C1(CN)CCOC1

Synonyms:

• 3-Ethyltetrahydro-3-furanmethanamine
• 3-Furanmethanamine, 3-ethyltetrahydro-