
CAS 1158766-97-2
:N,N-Dimethyl-1H-indazole-6-methanamine
Description:
N,N-Dimethyl-1H-indazole-6-methanamine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of the dimethylamino group at the nitrogen atom and a methanamine substituent at the 6-position of the indazole contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine functional group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as indazole derivatives are known for various biological activities. Additionally, the compound may participate in hydrogen bonding due to the amine group, influencing its reactivity and interactions with other molecules. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use in laboratory or industrial settings.
Formula:C10H13N3
InChI:InChI=1S/C10H13N3/c1-13(2)7-8-3-4-9-6-11-12-10(9)5-8/h3-6H,7H2,1-2H3,(H,11,12)
InChI key:InChIKey=KQGWTWXMELHUBC-UHFFFAOYSA-N
SMILES:C(N(C)C)C=1C=C2C(=CC1)C=NN2
Synonyms:- 1H-Indazole-6-methanamine, N,N-dimethyl-
- N,N-Dimethyl-1H-indazole-6-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.